C10H16O3S — CID 14565894
(E)-2-methyl-4-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)but-2-en-1-ol (PubChem CID 14565894) has the molecular formula C10H16O3S and a molecular weight of 216.30 g/mol. Its IUPAC name is (E)-2-methyl-4-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)but-2-en-1-ol.
| Compound Name | (E)-2-methyl-4-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)but-2-en-1-ol |
|---|---|
| PubChem CID | 14565894 |
| Molecular Formula | C10H16O3S |
| Molecular Weight | 216.30 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | (E)-2-methyl-4-(3-methyl-1,1-dioxo-2,5-dihydrothiophen-2-yl)but-2-en-1-ol |
| SMILES | CC1=CCS(=O)(=O)C1C/C=C(\C)CO |
| InChI | InChI=1S/C10H16O3S/c1-8(7-11)3-4-10-9(2)5-6-14(10,12)13/h3,5,10-11H,4,6-7H2,1-2H3/b8-3+ |
| InChIKey | PVXJYODFZUGARK-FPYGCLRLSA-N |
| XLogP | 1.06 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.30 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|