C9H16O3S — CID 103971432
(1Z)-1-(2-methylsulfonylcyclopentylidene)propan-2-ol (PubChem CID 103971432) has the molecular formula C9H16O3S and a molecular weight of 204.29 g/mol. Its IUPAC name is (1Z)-1-(2-methylsulfonylcyclopentylidene)propan-2-ol.
| Compound Name | (1Z)-1-(2-methylsulfonylcyclopentylidene)propan-2-ol |
|---|---|
| PubChem CID | 103971432 |
| Molecular Formula | C9H16O3S |
| Molecular Weight | 204.29 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | (1Z)-1-(2-methylsulfonylcyclopentylidene)propan-2-ol |
| SMILES | CC(O)/C=C1/CCCC1S(C)(=O)=O |
| InChI | InChI=1S/C9H16O3S/c1-7(10)6-8-4-3-5-9(8)13(2,11)12/h6-7,9-10H,3-5H2,1-2H3/b8-6- |
| InChIKey | KRLZOZXGOCJXNQ-VURMDHGXSA-N |
| XLogP | 0.89 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.29 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|