C10H20OS — CID 11159783
(E,2R,5S)-6,6-dimethyl-5-methylsulfanylhept-3-en-2-ol (PubChem CID 11159783) has the molecular formula C10H20OS and a molecular weight of 188.34 g/mol. Its IUPAC name is (E,2R,5S)-6,6-dimethyl-5-methylsulfanylhept-3-en-2-ol.
| Compound Name | (E,2R,5S)-6,6-dimethyl-5-methylsulfanylhept-3-en-2-ol |
|---|---|
| PubChem CID | 11159783 |
| Molecular Formula | C10H20OS |
| Molecular Weight | 188.34 g/mol |
| Exact Mass | 188.12 |
| IUPAC Name | (E,2R,5S)-6,6-dimethyl-5-methylsulfanylhept-3-en-2-ol |
| SMILES | CS[C@@H](/C=C/[C@@H](C)O)C(C)(C)C |
| InChI | InChI=1S/C10H20OS/c1-8(11)6-7-9(12-5)10(2,3)4/h6-9,11H,1-5H3/b7-6+/t8-,9+/m1/s1 |
| InChIKey | XMOUWAQGAHVVCM-BXELRRQVSA-N |
| XLogP | 2.70 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|