C10H18OS — CID 13263786
(1E,5E)-1-propan-2-ylsulfanylhepta-1,5-dien-4-ol (PubChem CID 13263786) has the molecular formula C10H18OS and a molecular weight of 186.32 g/mol. Its IUPAC name is (1E,5E)-1-propan-2-ylsulfanylhepta-1,5-dien-4-ol.
| Compound Name | (1E,5E)-1-propan-2-ylsulfanylhepta-1,5-dien-4-ol |
|---|---|
| PubChem CID | 13263786 |
| Molecular Formula | C10H18OS |
| Molecular Weight | 186.32 g/mol |
| Exact Mass | 186.11 |
| IUPAC Name | (1E,5E)-1-propan-2-ylsulfanylhepta-1,5-dien-4-ol |
| SMILES | C/C=C/C(O)C/C=C/SC(C)C |
| InChI | InChI=1S/C10H18OS/c1-4-6-10(11)7-5-8-12-9(2)3/h4-6,8-11H,7H2,1-3H3/b6-4+,8-5+ |
| InChIKey | JUNHXCDZWRYSQW-HLQBBKRNSA-N |
| XLogP | 2.97 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.32 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|