C11H20OS2 — CID 135044471
(E)-7-(1,3-dithian-2-yl)hept-4-en-3-ol (PubChem CID 135044471) has the molecular formula C11H20OS2 and a molecular weight of 232.41 g/mol. Its IUPAC name is (E)-7-(1,3-dithian-2-yl)hept-4-en-3-ol.
| Compound Name | (E)-7-(1,3-dithian-2-yl)hept-4-en-3-ol |
|---|---|
| PubChem CID | 135044471 |
| Molecular Formula | C11H20OS2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | (E)-7-(1,3-dithian-2-yl)hept-4-en-3-ol |
| SMILES | CCC(O)/C=C/CCC1SCCCS1 |
| InChI | InChI=1S/C11H20OS2/c1-2-10(12)6-3-4-7-11-13-8-5-9-14-11/h3,6,10-12H,2,4-5,7-9H2,1H3/b6-3+ |
| InChIKey | XINUMRGDJMOZID-ZZXKWVIFSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|