C15H28O2S2 — CID 135030457
(1R)-1-[2-[(E)-5-hydroxypent-3-enyl]-1,3-dithian-2-yl]hexan-1-ol (PubChem CID 135030457) has the molecular formula C15H28O2S2 and a molecular weight of 304.52 g/mol. Its IUPAC name is (1R)-1-[2-[(E)-5-hydroxypent-3-enyl]-1,3-dithian-2-yl]hexan-1-ol.
| Compound Name | (1R)-1-[2-[(E)-5-hydroxypent-3-enyl]-1,3-dithian-2-yl]hexan-1-ol |
|---|---|
| PubChem CID | 135030457 |
| Molecular Formula | C15H28O2S2 |
| Molecular Weight | 304.52 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | (1R)-1-[2-[(E)-5-hydroxypent-3-enyl]-1,3-dithian-2-yl]hexan-1-ol |
| SMILES | CCCCC[C@@H](O)C1(CC/C=C/CO)SCCCS1 |
| InChI | InChI=1S/C15H28O2S2/c1-2-3-5-9-14(17)15(10-6-4-7-11-16)18-12-8-13-19-15/h4,7,14,16-17H,2-3,5-6,8-13H2,1H3/b7-4+/t14-/m1/s1 |
| InChIKey | ZGQSTLZYFQWOGG-BTKRWWFXSA-N |
| XLogP | 3.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.52 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|