C13H24OS2 — CID 10901377
5-(2-but-3-enyl-1,3-dithian-2-yl)pentan-2-ol (PubChem CID 10901377) has the molecular formula C13H24OS2 and a molecular weight of 260.47 g/mol. Its IUPAC name is 5-(2-but-3-enyl-1,3-dithian-2-yl)pentan-2-ol.
| Compound Name | 5-(2-but-3-enyl-1,3-dithian-2-yl)pentan-2-ol |
|---|---|
| PubChem CID | 10901377 |
| Molecular Formula | C13H24OS2 |
| Molecular Weight | 260.47 g/mol |
| Exact Mass | 260.13 |
| IUPAC Name | 5-(2-but-3-enyl-1,3-dithian-2-yl)pentan-2-ol |
| SMILES | C=CCCC1(CCCC(C)O)SCCCS1 |
| InChI | InChI=1S/C13H24OS2/c1-3-4-8-13(9-5-7-12(2)14)15-10-6-11-16-13/h3,12,14H,1,4-11H2,2H3 |
| InChIKey | RCBAHEZQZPTWIG-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|