C11H20OS2 — CID 139252756
2-(2-pent-4-enyl-1,3-dithian-2-yl)ethanol (PubChem CID 139252756) has the molecular formula C11H20OS2 and a molecular weight of 232.41 g/mol. Its IUPAC name is 2-(2-pent-4-enyl-1,3-dithian-2-yl)ethanol.
| Compound Name | 2-(2-pent-4-enyl-1,3-dithian-2-yl)ethanol |
|---|---|
| PubChem CID | 139252756 |
| Molecular Formula | C11H20OS2 |
| Molecular Weight | 232.41 g/mol |
| Exact Mass | 232.10 |
| IUPAC Name | 2-(2-pent-4-enyl-1,3-dithian-2-yl)ethanol |
| SMILES | C=CCCCC1(CCO)SCCCS1 |
| InChI | InChI=1S/C11H20OS2/c1-2-3-4-6-11(7-8-12)13-9-5-10-14-11/h2,12H,1,3-10H2 |
| InChIKey | ZONRWCRWZNJYEM-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|