C11H18OS2 — CID 615410
3-(2-methyl-1,3-dithian-2-yl)cyclohex-2-en-1-ol (PubChem CID 615410) has the molecular formula C11H18OS2 and a molecular weight of 230.40 g/mol. Its IUPAC name is 3-(2-methyl-1,3-dithian-2-yl)cyclohex-2-en-1-ol.
| Compound Name | 3-(2-methyl-1,3-dithian-2-yl)cyclohex-2-en-1-ol |
|---|---|
| PubChem CID | 615410 |
| Molecular Formula | C11H18OS2 |
| Molecular Weight | 230.40 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 3-(2-methyl-1,3-dithian-2-yl)cyclohex-2-en-1-ol |
| SMILES | CC1(C2=CC(O)CCC2)SCCCS1 |
| InChI | InChI=1S/C11H18OS2/c1-11(13-6-3-7-14-11)9-4-2-5-10(12)8-9/h8,10,12H,2-7H2,1H3 |
| InChIKey | QMDVEVOZPORTGD-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.40 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|