C17H32O2S2 — CID 135030724
(E)-7-[2-[(1R)-1-hydroxyhexyl]-1,3-dithian-2-yl]hept-4-en-3-ol (PubChem CID 135030724) has the molecular formula C17H32O2S2 and a molecular weight of 332.57 g/mol. Its IUPAC name is (E)-7-[2-[(1R)-1-hydroxyhexyl]-1,3-dithian-2-yl]hept-4-en-3-ol.
| Compound Name | (E)-7-[2-[(1R)-1-hydroxyhexyl]-1,3-dithian-2-yl]hept-4-en-3-ol |
|---|---|
| PubChem CID | 135030724 |
| Molecular Formula | C17H32O2S2 |
| Molecular Weight | 332.57 g/mol |
| Exact Mass | 332.18 |
| IUPAC Name | (E)-7-[2-[(1R)-1-hydroxyhexyl]-1,3-dithian-2-yl]hept-4-en-3-ol |
| SMILES | CCCCC[C@@H](O)C1(CC/C=C/C(O)CC)SCCCS1 |
| InChI | InChI=1S/C17H32O2S2/c1-3-5-6-11-16(19)17(20-13-9-14-21-17)12-8-7-10-15(18)4-2/h7,10,15-16,18-19H,3-6,8-9,11-14H2,1-2H3/b10-7+/t15?,16-/m1/s1 |
| InChIKey | BFZIIUSNRQZKDA-QWFPWRQRSA-N |
| XLogP | 4.60 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|