C24H44O2S2 — CID 11133750
3-[2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1,3-dithian-2-yl]propane-1,2-diol (PubChem CID 11133750) has the molecular formula C24H44O2S2 and a molecular weight of 428.75 g/mol. Its IUPAC name is 3-[2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1,3-dithian-2-yl]propane-1,2-diol.
| Compound Name | 3-[2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1,3-dithian-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 11133750 |
| Molecular Formula | C24H44O2S2 |
| Molecular Weight | 428.75 g/mol |
| Exact Mass | 428.28 |
| IUPAC Name | 3-[2-[(8Z,11Z)-heptadeca-8,11-dienyl]-1,3-dithian-2-yl]propane-1,2-diol |
| SMILES | CCCCC/C=C\C/C=C\CCCCCCCC1(CC(O)CO)SCCCS1 |
| InChI | InChI=1S/C24H44O2S2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-18-24(21-23(26)22-25)27-19-17-20-28-24/h6-7,9-10,23,25-26H,2-5,8,11-22H2,1H3/b7-6-,10-9- |
| InChIKey | XTXQFEZYTZTZLU-HZJYTTRNSA-N |
| XLogP | 7.11 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.75 |
| LogP ≤ 5 | 7.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|