C20H40O2S — CID 123213780
2-methylsulfanylnonadec-4-ene-1,3-diol (PubChem CID 123213780) has the molecular formula C20H40O2S and a molecular weight of 344.61 g/mol. Its IUPAC name is 2-methylsulfanylnonadec-4-ene-1,3-diol.
| Compound Name | 2-methylsulfanylnonadec-4-ene-1,3-diol |
|---|---|
| PubChem CID | 123213780 |
| Molecular Formula | C20H40O2S |
| Molecular Weight | 344.61 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | 2-methylsulfanylnonadec-4-ene-1,3-diol |
| SMILES | CCCCCCCCCCCCCCC=CC(O)C(CO)SC |
| InChI | InChI=1S/C20H40O2S/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-19(22)20(18-21)23-2/h16-17,19-22H,3-15,18H2,1-2H3 |
| InChIKey | QLOLLJAZUIRGOM-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.61 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|