C19H34OS — CID 59977221
(6S,7E,9Z)-12-[(Z)-hept-2-enyl]sulfanyldodeca-7,9-dien-6-ol (PubChem CID 59977221) has the molecular formula C19H34OS and a molecular weight of 310.55 g/mol. Its IUPAC name is (6S,7E,9Z)-12-[(Z)-hept-2-enyl]sulfanyldodeca-7,9-dien-6-ol.
| Compound Name | (6S,7E,9Z)-12-[(Z)-hept-2-enyl]sulfanyldodeca-7,9-dien-6-ol |
|---|---|
| PubChem CID | 59977221 |
| Molecular Formula | C19H34OS |
| Molecular Weight | 310.55 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | (6S,7E,9Z)-12-[(Z)-hept-2-enyl]sulfanyldodeca-7,9-dien-6-ol |
| SMILES | CCCC/C=C\CSCC/C=C\C=C\[C@@H](O)CCCCC |
| InChI | InChI=1S/C19H34OS/c1-3-5-7-9-13-17-21-18-14-10-8-12-16-19(20)15-11-6-4-2/h8-10,12-13,16,19-20H,3-7,11,14-15,17-18H2,1-2H3/b10-8-,13-9-,16-12+/t19-/m0/s1 |
| InChIKey | RPYDKPMDFWOULE-PBVHAWHTSA-N |
| XLogP | 5.91 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.55 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|