C18H32OS — CID 59871697
(2Z,4E,6S)-1-[(Z)-hept-2-enyl]sulfanylundeca-2,4-dien-6-ol (PubChem CID 59871697) has the molecular formula C18H32OS and a molecular weight of 296.52 g/mol. Its IUPAC name is (2Z,4E,6S)-1-[(Z)-hept-2-enyl]sulfanylundeca-2,4-dien-6-ol.
| Compound Name | (2Z,4E,6S)-1-[(Z)-hept-2-enyl]sulfanylundeca-2,4-dien-6-ol |
|---|---|
| PubChem CID | 59871697 |
| Molecular Formula | C18H32OS |
| Molecular Weight | 296.52 g/mol |
| Exact Mass | 296.22 |
| IUPAC Name | (2Z,4E,6S)-1-[(Z)-hept-2-enyl]sulfanylundeca-2,4-dien-6-ol |
| SMILES | CCCC/C=C\CSC/C=C\C=C\[C@@H](O)CCCCC |
| InChI | InChI=1S/C18H32OS/c1-3-5-7-8-12-16-20-17-13-9-11-15-18(19)14-10-6-4-2/h8-9,11-13,15,18-19H,3-7,10,14,16-17H2,1-2H3/b12-8-,13-9-,15-11+/t18-/m0/s1 |
| InChIKey | OPQZEDWIJUDMLF-AWFKHOHSSA-N |
| XLogP | 5.52 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.52 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|