C20H36O — CID 59125743
(6R,7E,9Z,15Z)-icosa-7,9,15-trien-6-ol (PubChem CID 59125743) has the molecular formula C20H36O and a molecular weight of 292.51 g/mol. Its IUPAC name is (6R,7E,9Z,15Z)-icosa-7,9,15-trien-6-ol.
| Compound Name | (6R,7E,9Z,15Z)-icosa-7,9,15-trien-6-ol |
|---|---|
| PubChem CID | 59125743 |
| Molecular Formula | C20H36O |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.28 |
| IUPAC Name | (6R,7E,9Z,15Z)-icosa-7,9,15-trien-6-ol |
| SMILES | CCCC/C=C\CCCC/C=C\C=C\[C@H](O)CCCCC |
| InChI | InChI=1S/C20H36O/c1-3-5-7-8-9-10-11-12-13-14-15-17-19-20(21)18-16-6-4-2/h8-9,14-15,17,19-21H,3-7,10-13,16,18H2,1-2H3/b9-8-,15-14-,19-17+/t20-/m1/s1 |
| InChIKey | DVJFPFLVSKAPDU-OEVXOJAJSA-N |
| XLogP | 6.35 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|