C17H24O2 — CID 11108083
(8E,10E,12S)-heptadeca-8,10-dien-4,6-diyne-1,12-diol (PubChem CID 11108083) has the molecular formula C17H24O2 and a molecular weight of 260.38 g/mol. Its IUPAC name is (8E,10E,12S)-heptadeca-8,10-dien-4,6-diyne-1,12-diol.
| Compound Name | (8E,10E,12S)-heptadeca-8,10-dien-4,6-diyne-1,12-diol |
|---|---|
| PubChem CID | 11108083 |
| Molecular Formula | C17H24O2 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.18 |
| IUPAC Name | (8E,10E,12S)-heptadeca-8,10-dien-4,6-diyne-1,12-diol |
| SMILES | CCCCC[C@H](O)/C=C/C=C/C#CC#CCCCO |
| InChI | InChI=1S/C17H24O2/c1-2-3-11-14-17(19)15-12-9-7-5-4-6-8-10-13-16-18/h7,9,12,15,17-19H,2-3,10-11,13-14,16H2,1H3/b9-7+,15-12+/t17-/m0/s1 |
| InChIKey | UYZBGAFJAALREV-WHLLTAFYSA-N |
| XLogP | 2.82 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|