About (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol
(8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol (PubChem CID 15736266) has the molecular formula C17H24O3
and a molecular weight of 276.38 g/mol. Its IUPAC name is (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol.
Molecular Properties
| Compound Name | (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol |
| PubChem CID | 15736266 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol |
| SMILES | C=CC(O)C#CC#C/C=C/C(CCCCCCC)OO |
| InChI | InChI=1S/C17H24O3/c1-3-5-6-7-11-14-17(20-19)15-12-9-8-10-13-16(18)4-2/h4,12,15-19H,2-3,5-7,11,14H2,1H3/b15-12+ |
| InChIKey | SYNBBWLEYQBFQT-NTCAYCPXSA-N |
| XLogP | 3.32 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol?
The IUPAC name of (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol (CID 15736266) is (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol.
What is the SMILES notation for (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol?
The canonical SMILES for (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol is C=CC(O)C#CC#C/C=C/C(CCCCCCC)OO.
What is the InChIKey of (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol?
The InChIKey is SYNBBWLEYQBFQT-NTCAYCPXSA-N. The full InChI is InChI=1S/C17H24O3/c1-3-5-6-7-11-14-17(20-19)15-12-9-8-10-13-16(18)4-2/h4,12,15-19H,2-3,5-7,11,14H2,1H3/b15-12+.
What are the key properties of (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol?
(8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol has a molecular weight of 276.38 g/mol, XLogP of 3.32, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8E)-10-hydroperoxyheptadeca-1,8-dien-4,6-diyn-3-ol is sourced from PubChem (CID 15736266), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).