C14H24O2S2 — CID 15441075
(1R,3Z,7R,8E)-1-(1,3-dithian-2-yl)deca-3,8-diene-1,7-diol (PubChem CID 15441075) has the molecular formula C14H24O2S2 and a molecular weight of 288.48 g/mol. Its IUPAC name is (1R,3Z,7R,8E)-1-(1,3-dithian-2-yl)deca-3,8-diene-1,7-diol.
| Compound Name | (1R,3Z,7R,8E)-1-(1,3-dithian-2-yl)deca-3,8-diene-1,7-diol |
|---|---|
| PubChem CID | 15441075 |
| Molecular Formula | C14H24O2S2 |
| Molecular Weight | 288.48 g/mol |
| Exact Mass | 288.12 |
| IUPAC Name | (1R,3Z,7R,8E)-1-(1,3-dithian-2-yl)deca-3,8-diene-1,7-diol |
| SMILES | C/C=C/[C@H](O)CC/C=C\C[C@@H](O)C1SCCCS1 |
| InChI | InChI=1S/C14H24O2S2/c1-2-7-12(15)8-4-3-5-9-13(16)14-17-10-6-11-18-14/h2-3,5,7,12-16H,4,6,8-11H2,1H3/b5-3-,7-2+/t12-,13+/m0/s1 |
| InChIKey | YJPGBICQFAFIIJ-PCAXASHSSA-N |
| XLogP | 3.21 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.48 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|