C8H14OS2 — CID 12595238
(E)-1-(1,3-dithian-2-yl)but-2-en-1-ol (PubChem CID 12595238) has the molecular formula C8H14OS2 and a molecular weight of 190.33 g/mol. Its IUPAC name is (E)-1-(1,3-dithian-2-yl)but-2-en-1-ol.
| Compound Name | (E)-1-(1,3-dithian-2-yl)but-2-en-1-ol |
|---|---|
| PubChem CID | 12595238 |
| Molecular Formula | C8H14OS2 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.05 |
| IUPAC Name | (E)-1-(1,3-dithian-2-yl)but-2-en-1-ol |
| SMILES | C/C=C/C(O)C1SCCCS1 |
| InChI | InChI=1S/C8H14OS2/c1-2-4-7(9)8-10-5-3-6-11-8/h2,4,7-9H,3,5-6H2,1H3/b4-2+ |
| InChIKey | MUSOLVVLXLGHNX-DUXPYHPUSA-N |
| XLogP | 2.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|