C11H18O2S — CID 138723781
6-(4-hydroxypentylsulfanyl)cyclohexa-2,4-dien-1-ol (PubChem CID 138723781) has the molecular formula C11H18O2S and a molecular weight of 214.33 g/mol. Its IUPAC name is 6-(4-hydroxypentylsulfanyl)cyclohexa-2,4-dien-1-ol.
| Compound Name | 6-(4-hydroxypentylsulfanyl)cyclohexa-2,4-dien-1-ol |
|---|---|
| PubChem CID | 138723781 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 6-(4-hydroxypentylsulfanyl)cyclohexa-2,4-dien-1-ol |
| SMILES | CC(O)CCCSC1C=CC=CC1O |
| InChI | InChI=1S/C11H18O2S/c1-9(12)5-4-8-14-11-7-3-2-6-10(11)13/h2-3,6-7,9-13H,4-5,8H2,1H3 |
| InChIKey | BDRMIBJHJVVNIR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|