About (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol
(4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol (PubChem CID 118052443) has the molecular formula C14H24OS
and a molecular weight of 240.41 g/mol. Its IUPAC name is (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol.
Molecular Properties
| Compound Name | (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol |
| PubChem CID | 118052443 |
| Molecular Formula | C14H24OS |
| Molecular Weight | 240.41 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol |
| SMILES | C=C/C=C(\C=C)C(O)C(C)(C)SCCCC |
| InChI | InChI=1S/C14H24OS/c1-6-9-11-16-14(4,5)13(15)12(8-3)10-7-2/h7-8,10,13,15H,2-3,6,9,11H2,1,4-5H3/b12-10+ |
| InChIKey | GZXBOOFXWATZCT-ZRDIBKRKSA-N |
| XLogP | 3.96 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.41 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol?
The IUPAC name of (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol (CID 118052443) is (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol.
What is the SMILES notation for (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol?
The canonical SMILES for (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol is C=C/C=C(\C=C)C(O)C(C)(C)SCCCC.
What is the InChIKey of (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol?
The InChIKey is GZXBOOFXWATZCT-ZRDIBKRKSA-N. The full InChI is InChI=1S/C14H24OS/c1-6-9-11-16-14(4,5)13(15)12(8-3)10-7-2/h7-8,10,13,15H,2-3,6,9,11H2,1,4-5H3/b12-10+.
What are the key properties of (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol?
(4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol has a molecular weight of 240.41 g/mol, XLogP of 3.96, 8 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4E)-2-butylsulfanyl-4-ethenyl-2-methylhepta-4,6-dien-3-ol is sourced from PubChem (CID 118052443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).