About tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol
tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol (PubChem CID 142254234) has the molecular formula C12H26OS
and a molecular weight of 218.41 g/mol. Its IUPAC name is tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol.
Molecular Properties
| Compound Name | tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol |
| PubChem CID | 142254234 |
| Molecular Formula | C12H26OS |
| Molecular Weight | 218.41 g/mol |
| Exact Mass | 218.17 |
| IUPAC Name | tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol |
| SMILES | CC(C)(C)S(C)(C)C.OC1C=CCC1 |
| InChI | InChI=1S/C7H18S.C5H8O/c1-7(2,3)8(4,5)6;6-5-3-1-2-4-5/h1-6H3;1,3,5-6H,2,4H2 |
| InChIKey | WDLVTRFBRFVODI-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.41 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol?
The IUPAC name of tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol (CID 142254234) is tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol.
What is the SMILES notation for tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol?
The canonical SMILES for tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol is CC(C)(C)S(C)(C)C.OC1C=CCC1.
What is the InChIKey of tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol?
The InChIKey is WDLVTRFBRFVODI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H18S.C5H8O/c1-7(2,3)8(4,5)6;6-5-3-1-2-4-5/h1-6H3;1,3,5-6H,2,4H2.
What are the key properties of tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol?
tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol has a molecular weight of 218.41 g/mol, XLogP of 3.18, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl(trimethyl)-λ4-sulfane;cyclopent-2-en-1-ol is sourced from PubChem (CID 142254234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).