About (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol
(1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol (PubChem CID 10997322) has the molecular formula C8H14OS
and a molecular weight of 158.27 g/mol. Its IUPAC name is (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol.
Analyze (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol?
The IUPAC name of (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol (CID 10997322) is (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol.
What is the SMILES notation for (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol?
The canonical SMILES for (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol is CSC1=CCC(C)(C)[C@@H]1O.
What is the InChIKey of (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol?
The InChIKey is DOQBLTOGBPHAQY-SSDOTTSWSA-N. The full InChI is InChI=1S/C8H14OS/c1-8(2)5-4-6(10-3)7(8)9/h4,7,9H,5H2,1-3H3/t7-/m1/s1.
What are the key properties of (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol?
(1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol has a molecular weight of 158.27 g/mol, XLogP of 2.02, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S)-5,5-dimethyl-2-methylsulfanylcyclopent-2-en-1-ol is sourced from PubChem (CID 10997322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).