About (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol
(1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol (PubChem CID 142254316) has the molecular formula C11H22O2S
and a molecular weight of 218.36 g/mol. Its IUPAC name is (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol.
Molecular Properties
| Compound Name | (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol |
| PubChem CID | 142254316 |
| Molecular Formula | C11H22O2S |
| Molecular Weight | 218.36 g/mol |
| Exact Mass | 218.13 |
| IUPAC Name | (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol |
| SMILES | CC(C)(C)S(C)(C)O[C@H]1C=C[C@@H](O)C1 |
| InChI | InChI=1S/C11H22O2S/c1-11(2,3)14(4,5)13-10-7-6-9(12)8-10/h6-7,9-10,12H,8H2,1-5H3/t9-,10+/m1/s1 |
| InChIKey | CMERNIPUWBQMFH-ZJUUUORDSA-N |
| XLogP | 2.47 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.36 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol?
The IUPAC name of (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol (CID 142254316) is (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol.
What is the SMILES notation for (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol?
The canonical SMILES for (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol is CC(C)(C)S(C)(C)O[C@H]1C=C[C@@H](O)C1.
What is the InChIKey of (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol?
The InChIKey is CMERNIPUWBQMFH-ZJUUUORDSA-N. The full InChI is InChI=1S/C11H22O2S/c1-11(2,3)14(4,5)13-10-7-6-9(12)8-10/h6-7,9-10,12H,8H2,1-5H3/t9-,10+/m1/s1.
What are the key properties of (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol?
(1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol has a molecular weight of 218.36 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,4R)-4-[tert-butyl(dimethyl)-λ4-sulfanyl]oxycyclopent-2-en-1-ol is sourced from PubChem (CID 142254316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).