C26H31NO7 — CID 102026590
3-O-ethyl 2-O,4-O-dimethyl (Z,4R,5S)-2-[[(1S)-1-naphthalen-2-ylethyl]amino]-6-oxohept-2-ene-2,3,4-tricarboxylate (PubChem CID 102026590) has the molecular formula C26H31NO7 and a molecular weight of 469.53 g/mol. Its IUPAC name is 3-O-ethyl 2-O,4-O-dimethyl (Z,4R,5S)-2-[[(1S)-1-naphthalen-2-ylethyl]amino]-6-oxohept-2-ene-2,3,4-tricarboxylate.
| Compound Name | 3-O-ethyl 2-O,4-O-dimethyl (Z,4R,5S)-2-[[(1S)-1-naphthalen-2-ylethyl]amino]-6-oxohept-2-ene-2,3,4-tricarboxylate |
|---|---|
| PubChem CID | 102026590 |
| Molecular Formula | C26H31NO7 |
| Molecular Weight | 469.53 g/mol |
| Exact Mass | 469.21 |
| IUPAC Name | 3-O-ethyl 2-O,4-O-dimethyl (Z,4R,5S)-2-[[(1S)-1-naphthalen-2-ylethyl]amino]-6-oxohept-2-ene-2,3,4-tricarboxylate |
| SMILES | CCOC(=O)[C@@H](/C(C(=O)OC)=C(\C)N[C@@H](C)c1ccc2ccccc2c1)[C@@H](C(C)=O)C(=O)OC |
| InChI | InChI=1S/C26H31NO7/c1-7-34-26(31)23(22(17(4)28)25(30)33-6)21(24(29)32-5)16(3)27-15(2)19-13-12-18-10-8-9-11-20(18)14-19/h8-15,22-23,27H,7H2,1-6H3/b21-16-/t15-,22+,23-/m0/s1 |
| InChIKey | FETJNDRSYOICIU-AKSQTPRYSA-N |
| XLogP | 3.49 |
| TPSA | 108.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|