C24H26BCl2NO — CID 10202681
2-bis(3-chloro-4-methylphenyl)boranyloxy-N-methyl-3-phenylpropan-1-amine (PubChem CID 10202681) has the molecular formula C24H26BCl2NO and a molecular weight of 426.20 g/mol. Its IUPAC name is 2-bis(3-chloro-4-methylphenyl)boranyloxy-N-methyl-3-phenylpropan-1-amine.
| Compound Name | 2-bis(3-chloro-4-methylphenyl)boranyloxy-N-methyl-3-phenylpropan-1-amine |
|---|---|
| PubChem CID | 10202681 |
| Molecular Formula | C24H26BCl2NO |
| Molecular Weight | 426.20 g/mol |
| Exact Mass | 425.15 |
| IUPAC Name | 2-bis(3-chloro-4-methylphenyl)boranyloxy-N-methyl-3-phenylpropan-1-amine |
| SMILES | CNCC(Cc1ccccc1)OB(c1ccc(C)c(Cl)c1)c1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C24H26BCl2NO/c1-17-9-11-20(14-23(17)26)25(21-12-10-18(2)24(27)15-21)29-22(16-28-3)13-19-7-5-4-6-8-19/h4-12,14-15,22,28H,13,16H2,1-3H3 |
| InChIKey | ASQGCYLXDFCNOD-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.20 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|