C11H14O2S2 — CID 102027576
6-methylsulfanyl-1-thiophen-2-ylhexane-1,4-dione (PubChem CID 102027576) has the molecular formula C11H14O2S2 and a molecular weight of 242.36 g/mol. Its IUPAC name is 6-methylsulfanyl-1-thiophen-2-ylhexane-1,4-dione.
| Compound Name | 6-methylsulfanyl-1-thiophen-2-ylhexane-1,4-dione |
|---|---|
| PubChem CID | 102027576 |
| Molecular Formula | C11H14O2S2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 6-methylsulfanyl-1-thiophen-2-ylhexane-1,4-dione |
| SMILES | CSCCC(=O)CCC(=O)c1cccs1 |
| InChI | InChI=1S/C11H14O2S2/c1-14-8-6-9(12)4-5-10(13)11-3-2-7-15-11/h2-3,7H,4-6,8H2,1H3 |
| InChIKey | RHPKMNOHNNFHGT-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |