C26H25N3O4S — CID 102027679
methyl (2S,3S)-2-(benzylamino)-3-phenyl-3-(quinolin-8-ylsulfonylamino)propanoate (PubChem CID 102027679) has the molecular formula C26H25N3O4S and a molecular weight of 475.57 g/mol. Its IUPAC name is methyl (2S,3S)-2-(benzylamino)-3-phenyl-3-(quinolin-8-ylsulfonylamino)propanoate.
| Compound Name | methyl (2S,3S)-2-(benzylamino)-3-phenyl-3-(quinolin-8-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 102027679 |
| Molecular Formula | C26H25N3O4S |
| Molecular Weight | 475.57 g/mol |
| Exact Mass | 475.16 |
| IUPAC Name | methyl (2S,3S)-2-(benzylamino)-3-phenyl-3-(quinolin-8-ylsulfonylamino)propanoate |
| SMILES | COC(=O)[C@@H](NCc1ccccc1)[C@@H](NS(=O)(=O)c1cccc2cccnc12)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O4S/c1-33-26(30)25(28-18-19-10-4-2-5-11-19)24(21-12-6-3-7-13-21)29-34(31,32)22-16-8-14-20-15-9-17-27-23(20)22/h2-17,24-25,28-29H,18H2,1H3/t24-,25-/m0/s1 |
| InChIKey | WWZAVIZRTJTFBA-DQEYMECFSA-N |
| XLogP | 3.59 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.57 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |