C25H38O5 — CID 102028264
[(1S,3E,7E,9R,10R)-10-(2-hydroxypropan-2-yl)-3,7-dimethyl-9-[(Z)-2-methylbut-2-enoyl]oxycyclodeca-3,7-dien-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 102028264) has the molecular formula C25H38O5 and a molecular weight of 418.57 g/mol. Its IUPAC name is [(1S,3E,7E,9R,10R)-10-(2-hydroxypropan-2-yl)-3,7-dimethyl-9-[(Z)-2-methylbut-2-enoyl]oxycyclodeca-3,7-dien-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1S,3E,7E,9R,10R)-10-(2-hydroxypropan-2-yl)-3,7-dimethyl-9-[(Z)-2-methylbut-2-enoyl]oxycyclodeca-3,7-dien-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 102028264 |
| Molecular Formula | C25H38O5 |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.27 |
| IUPAC Name | [(1S,3E,7E,9R,10R)-10-(2-hydroxypropan-2-yl)-3,7-dimethyl-9-[(Z)-2-methylbut-2-enoyl]oxycyclodeca-3,7-dien-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1C/C(C)=C/CC/C(C)=C/[C@@H](OC(=O)/C(C)=C\C)[C@@H]1C(C)(C)O |
| InChI | InChI=1S/C25H38O5/c1-9-18(5)23(26)29-20-14-16(3)12-11-13-17(4)15-21(22(20)25(7,8)28)30-24(27)19(6)10-2/h9-10,12,15,20-22,28H,11,13-14H2,1-8H3/b16-12+,17-15+,18-9-,19-10-/t20-,21+,22+/m0/s1 |
| InChIKey | WLUZYQDSHYPPAK-CMRUBYLVSA-N |
| XLogP | 5.21 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|