C28H44O7 — CID 162882544
[3-acetyloxy-2-(3,7-dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-yl)oxy-5-hydroxy-6-methyloxan-4-yl] 2-methylbut-2-enoate (PubChem CID 162882544) has the molecular formula C28H44O7 and a molecular weight of 492.65 g/mol. Its IUPAC name is [3-acetyloxy-2-(3,7-dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-yl)oxy-5-hydroxy-6-methyloxan-4-yl] 2-methylbut-2-enoate.
| Compound Name | [3-acetyloxy-2-(3,7-dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-yl)oxy-5-hydroxy-6-methyloxan-4-yl] 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162882544 |
| Molecular Formula | C28H44O7 |
| Molecular Weight | 492.65 g/mol |
| Exact Mass | 492.31 |
| IUPAC Name | [3-acetyloxy-2-(3,7-dimethyl-10-propan-2-ylcyclodeca-2,6-dien-1-yl)oxy-5-hydroxy-6-methyloxan-4-yl] 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1C(O)C(C)OC(OC2C=C(C)CCC=C(C)CCC2C(C)C)C1OC(C)=O |
| InChI | InChI=1S/C28H44O7/c1-9-19(6)27(31)35-25-24(30)20(7)32-28(26(25)33-21(8)29)34-23-15-18(5)12-10-11-17(4)13-14-22(23)16(2)3/h9,11,15-16,20,22-26,28,30H,10,12-14H2,1-8H3 |
| InChIKey | CCINNFNVGBXOKP-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.65 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|