C24H24N2O2 — CID 102028482
benzyl (2S,5R)-2-phenyl-5-(pyridin-3-ylmethyl)pyrrolidine-1-carboxylate (PubChem CID 102028482) has the molecular formula C24H24N2O2 and a molecular weight of 372.47 g/mol. Its IUPAC name is benzyl (2S,5R)-2-phenyl-5-(pyridin-3-ylmethyl)pyrrolidine-1-carboxylate.
| Compound Name | benzyl (2S,5R)-2-phenyl-5-(pyridin-3-ylmethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 102028482 |
| Molecular Formula | C24H24N2O2 |
| Molecular Weight | 372.47 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | benzyl (2S,5R)-2-phenyl-5-(pyridin-3-ylmethyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OCc1ccccc1)N1[C@@H](Cc2cccnc2)CC[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H24N2O2/c27-24(28-18-19-8-3-1-4-9-19)26-22(16-20-10-7-15-25-17-20)13-14-23(26)21-11-5-2-6-12-21/h1-12,15,17,22-23H,13-14,16,18H2/t22-,23+/m1/s1 |
| InChIKey | SQXJAGFOXIMPHC-PKTZIBPZSA-N |
| XLogP | 5.17 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.47 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |