C20H25N3O3 — CID 175291873
benzyl 2-[(1S)-1-methoxyethyl]-6-pyridin-3-ylpiperazine-1-carboxylate (PubChem CID 175291873) has the molecular formula C20H25N3O3 and a molecular weight of 355.44 g/mol. Its IUPAC name is benzyl 2-[(1S)-1-methoxyethyl]-6-pyridin-3-ylpiperazine-1-carboxylate.
| Compound Name | benzyl 2-[(1S)-1-methoxyethyl]-6-pyridin-3-ylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175291873 |
| Molecular Formula | C20H25N3O3 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | benzyl 2-[(1S)-1-methoxyethyl]-6-pyridin-3-ylpiperazine-1-carboxylate |
| SMILES | CO[C@@H](C)C1CNCC(c2cccnc2)N1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H25N3O3/c1-15(25-2)18-12-22-13-19(17-9-6-10-21-11-17)23(18)20(24)26-14-16-7-4-3-5-8-16/h3-11,15,18-19,22H,12-14H2,1-2H3/t15-,18?,19?/m0/s1 |
| InChIKey | FRTOXMCYIQMBKR-MNNVXMFVSA-N |
| XLogP | 2.77 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |