About dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate
dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate (PubChem CID 102029136) has the molecular formula C28H28O5
and a molecular weight of 444.53 g/mol. Its IUPAC name is dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate.
Molecular Properties
| Compound Name | dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate |
| PubChem CID | 102029136 |
| Molecular Formula | C28H28O5 |
| Molecular Weight | 444.53 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate |
| SMILES | CC(=O)C[C@@H](c1ccc(C)cc1)C(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C28H28O5/c1-20-13-15-24(16-14-20)25(17-21(2)29)26(27(30)32-18-22-9-5-3-6-10-22)28(31)33-19-23-11-7-4-8-12-23/h3-16,25-26H,17-19H2,1-2H3/t25-/m0/s1 |
| InChIKey | LDBMPMIHWYLWQO-VWLOTQADSA-N |
| XLogP | 5.16 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 444.53 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate?
The IUPAC name of dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate (CID 102029136) is dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate.
What is the SMILES notation for dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate?
The canonical SMILES for dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate is CC(=O)C[C@@H](c1ccc(C)cc1)C(C(=O)OCc1ccccc1)C(=O)OCc1ccccc1.
What is the InChIKey of dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate?
The InChIKey is LDBMPMIHWYLWQO-VWLOTQADSA-N. The full InChI is InChI=1S/C28H28O5/c1-20-13-15-24(16-14-20)25(17-21(2)29)26(27(30)32-18-22-9-5-3-6-10-22)28(31)33-19-23-11-7-4-8-12-23/h3-16,25-26H,17-19H2,1-2H3/t25-/m0/s1.
What are the key properties of dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate?
dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate has a molecular weight of 444.53 g/mol, XLogP of 5.16, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl 2-[(1R)-1-(4-methylphenyl)-3-oxobutyl]propanedioate is sourced from PubChem (CID 102029136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).