C22H33NO3 — CID 102029533
5-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,3-oxazolidin-2-one (PubChem CID 102029533) has the molecular formula C22H33NO3 and a molecular weight of 359.51 g/mol. Its IUPAC name is 5-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,3-oxazolidin-2-one.
| Compound Name | 5-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,3-oxazolidin-2-one |
|---|---|
| PubChem CID | 102029533 |
| Molecular Formula | C22H33NO3 |
| Molecular Weight | 359.51 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | 5-[(3S,8S,9S,10R,13S,14S,17S)-3-hydroxy-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]-1,3-oxazolidin-2-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CC=C4C[C@@H](O)CC[C@@]43C)[C@@H]1CC[C@@H]2C1CNC(=O)O1 |
| InChI | InChI=1S/C22H33NO3/c1-21-9-7-14(24)11-13(21)3-4-15-16-5-6-18(19-12-23-20(25)26-19)22(16,2)10-8-17(15)21/h3,14-19,24H,4-12H2,1-2H3,(H,23,25)/t14-,15-,16-,17-,18+,19?,21-,22-/m0/s1 |
| InChIKey | JWGCDSZFEASUOH-RNMSGCPLSA-N |
| XLogP | 4.03 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.51 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|