C10H11NOSe — CID 102032359
3-(4-methylphenyl)-1,3-selenazolidin-2-one (PubChem CID 102032359) has the molecular formula C10H11NOSe and a molecular weight of 240.16 g/mol. Its IUPAC name is 3-(4-methylphenyl)-1,3-selenazolidin-2-one.
| Compound Name | 3-(4-methylphenyl)-1,3-selenazolidin-2-one |
|---|---|
| PubChem CID | 102032359 |
| Molecular Formula | C10H11NOSe |
| Molecular Weight | 240.16 g/mol |
| Exact Mass | 241.00 |
| IUPAC Name | 3-(4-methylphenyl)-1,3-selenazolidin-2-one |
| SMILES | Cc1ccc(N2CC[Se]C2=O)cc1 |
| InChI | InChI=1S/C10H11NOSe/c1-8-2-4-9(5-3-8)11-6-7-13-10(11)12/h2-5H,6-7H2,1H3 |
| InChIKey | GKNFEWSBERVJGM-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.16 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|