About (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one
(1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one (PubChem CID 102034066) has the molecular formula C10H12N2O
and a molecular weight of 176.22 g/mol. Its IUPAC name is (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one.
Analyze (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one?
The IUPAC name of (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one (CID 102034066) is (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one.
What is the SMILES notation for (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one?
The canonical SMILES for (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one is O=c1cccc2n1C[C@H]1CN[C@@H]2C1.
What is the InChIKey of (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one?
The InChIKey is NNRCSYNIECKSBE-HTQZYQBOSA-N. The full InChI is InChI=1S/C10H12N2O/c13-10-3-1-2-9-8-4-7(5-11-8)6-12(9)10/h1-3,7-8,11H,4-6H2/t7-,8-/m1/s1.
What are the key properties of (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one?
(1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one has a molecular weight of 176.22 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1R,9R)-7,11-diazatricyclo[7.2.1.02,7]dodeca-2,4-dien-6-one is sourced from PubChem (CID 102034066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).