C23H19N3O5 — CID 102034305
[(1R,9S,10R)-5-benzoylimino-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methyl benzoate (PubChem CID 102034305) has the molecular formula C23H19N3O5 and a molecular weight of 417.42 g/mol. Its IUPAC name is [(1R,9S,10R)-5-benzoylimino-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methyl benzoate.
| Compound Name | [(1R,9S,10R)-5-benzoylimino-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methyl benzoate |
|---|---|
| PubChem CID | 102034305 |
| Molecular Formula | C23H19N3O5 |
| Molecular Weight | 417.42 g/mol |
| Exact Mass | 417.13 |
| IUPAC Name | [(1R,9S,10R)-5-benzoylimino-8,11-dioxa-2,6-diazatricyclo[7.2.1.02,7]dodeca-3,6-dien-10-yl]methyl benzoate |
| SMILES | O=C(/N=c1\ccn2c(n1)O[C@H]1C[C@H]2O[C@@H]1COC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H19N3O5/c27-21(15-7-3-1-4-8-15)24-19-11-12-26-20-13-17(31-23(26)25-19)18(30-20)14-29-22(28)16-9-5-2-6-10-16/h1-12,17-18,20H,13-14H2/b24-19+/t17-,18+,20+/m0/s1 |
| InChIKey | GRMOSXGXSKWJOK-KSMORTMMSA-N |
| XLogP | 2.53 |
| TPSA | 92.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.42 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |