C17H22BrO4- — CID 102034323
5-(4-bromophenoxy)-5-oxo-3,3-di(propan-2-yl)pentanoate (PubChem CID 102034323) has the molecular formula C17H22BrO4- and a molecular weight of 370.26 g/mol. Its IUPAC name is 5-(4-bromophenoxy)-5-oxo-3,3-di(propan-2-yl)pentanoate.
| Compound Name | 5-(4-bromophenoxy)-5-oxo-3,3-di(propan-2-yl)pentanoate |
|---|---|
| PubChem CID | 102034323 |
| Molecular Formula | C17H22BrO4- |
| Molecular Weight | 370.26 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 5-(4-bromophenoxy)-5-oxo-3,3-di(propan-2-yl)pentanoate |
| SMILES | CC(C)C(CC(=O)[O-])(CC(=O)Oc1ccc(Br)cc1)C(C)C |
| InChI | InChI=1S/C17H23BrO4/c1-11(2)17(12(3)4,9-15(19)20)10-16(21)22-14-7-5-13(18)6-8-14/h5-8,11-12H,9-10H2,1-4H3,(H,19,20)/p-1 |
| InChIKey | WAQQYXUGWVQRCM-UHFFFAOYSA-M |
| XLogP | 3.18 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.26 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|