C15H13N3O2 — CID 102035420
5-[4-(benzylamino)phenyl]-3H-1,3,4-oxadiazol-2-one (PubChem CID 102035420) has the molecular formula C15H13N3O2 and a molecular weight of 267.29 g/mol. Its IUPAC name is 5-[4-(benzylamino)phenyl]-3H-1,3,4-oxadiazol-2-one.
| Compound Name | 5-[4-(benzylamino)phenyl]-3H-1,3,4-oxadiazol-2-one |
|---|---|
| PubChem CID | 102035420 |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.29 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 5-[4-(benzylamino)phenyl]-3H-1,3,4-oxadiazol-2-one |
| SMILES | O=c1[nH]nc(-c2ccc(NCc3ccccc3)cc2)o1 |
| InChI | InChI=1S/C15H13N3O2/c19-15-18-17-14(20-15)12-6-8-13(9-7-12)16-10-11-4-2-1-3-5-11/h1-9,16H,10H2,(H,18,19) |
| InChIKey | HSFXZKZSYKJCAW-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.29 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |