C10H16INO — CID 102036322
(1R,3S,8aR)-3-[(Z)-2-iodoethenyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-ol (PubChem CID 102036322) has the molecular formula C10H16INO and a molecular weight of 293.15 g/mol. Its IUPAC name is (1R,3S,8aR)-3-[(Z)-2-iodoethenyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-ol.
| Compound Name | (1R,3S,8aR)-3-[(Z)-2-iodoethenyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-ol |
|---|---|
| PubChem CID | 102036322 |
| Molecular Formula | C10H16INO |
| Molecular Weight | 293.15 g/mol |
| Exact Mass | 293.03 |
| IUPAC Name | (1R,3S,8aR)-3-[(Z)-2-iodoethenyl]-1,2,3,5,6,7,8,8a-octahydroindolizin-1-ol |
| SMILES | O[C@@H]1C[C@@H](/C=C\I)N2CCCC[C@H]12 |
| InChI | InChI=1S/C10H16INO/c11-5-4-8-7-10(13)9-3-1-2-6-12(8)9/h4-5,8-10,13H,1-3,6-7H2/b5-4-/t8-,9-,10-/m1/s1 |
| InChIKey | AHGPTBXKUNCMTE-ANOCTECISA-N |
| XLogP | 1.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.15 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|