C11H19NO — CID 5231831
3-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-ol (PubChem CID 5231831) has the molecular formula C11H19NO and a molecular weight of 181.28 g/mol. Its IUPAC name is 3-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-ol.
| Compound Name | 3-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-ol |
|---|---|
| PubChem CID | 5231831 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 3-prop-2-enyl-1,2,3,5,6,7,8,8a-octahydroindolizin-2-ol |
| SMILES | C=CCC1C(O)CC2CCCCN21 |
| InChI | InChI=1S/C11H19NO/c1-2-5-10-11(13)8-9-6-3-4-7-12(9)10/h2,9-11,13H,1,3-8H2 |
| InChIKey | YTNCUFVCIFTYRU-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|