C17H31NO — CID 91731710
4-(5-pent-4-enyl-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)butan-2-ol (PubChem CID 91731710) has the molecular formula C17H31NO and a molecular weight of 265.44 g/mol. Its IUPAC name is 4-(5-pent-4-enyl-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)butan-2-ol.
| Compound Name | 4-(5-pent-4-enyl-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)butan-2-ol |
|---|---|
| PubChem CID | 91731710 |
| Molecular Formula | C17H31NO |
| Molecular Weight | 265.44 g/mol |
| Exact Mass | 265.24 |
| IUPAC Name | 4-(5-pent-4-enyl-1,2,3,5,6,7,8,8a-octahydroindolizin-3-yl)butan-2-ol |
| SMILES | C=CCCCC1CCCC2CCC(CCC(C)O)N12 |
| InChI | InChI=1S/C17H31NO/c1-3-4-5-7-15-8-6-9-16-12-13-17(18(15)16)11-10-14(2)19/h3,14-17,19H,1,4-13H2,2H3 |
| InChIKey | HFZAZMPNNDWEMD-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.44 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|