C11H19NO2 — CID 163660256
(5R)-8-(2-hydroxybut-3-enyl)-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 163660256) has the molecular formula C11H19NO2 and a molecular weight of 197.28 g/mol. Its IUPAC name is (5R)-8-(2-hydroxybut-3-enyl)-8-azabicyclo[3.2.1]octan-3-ol.
| Compound Name | (5R)-8-(2-hydroxybut-3-enyl)-8-azabicyclo[3.2.1]octan-3-ol |
|---|---|
| PubChem CID | 163660256 |
| Molecular Formula | C11H19NO2 |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.14 |
| IUPAC Name | (5R)-8-(2-hydroxybut-3-enyl)-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | C=CC(O)CN1C2CC[C@@H]1CC(O)C2 |
| InChI | InChI=1S/C11H19NO2/c1-2-10(13)7-12-8-3-4-9(12)6-11(14)5-8/h2,8-11,13-14H,1,3-7H2/t8-,9?,10?,11?/m1/s1 |
| InChIKey | ITUBPHIEJHDBEH-XUHYKBHQSA-N |
| XLogP | 0.52 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|