C13H10O2S — CID 102037295
[(2S,3R)-3-phenyloxiran-2-yl]-thiophen-3-ylmethanone (PubChem CID 102037295) has the molecular formula C13H10O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is [(2S,3R)-3-phenyloxiran-2-yl]-thiophen-3-ylmethanone.
| Compound Name | [(2S,3R)-3-phenyloxiran-2-yl]-thiophen-3-ylmethanone |
|---|---|
| PubChem CID | 102037295 |
| Molecular Formula | C13H10O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | [(2S,3R)-3-phenyloxiran-2-yl]-thiophen-3-ylmethanone |
| SMILES | O=C(c1ccsc1)[C@H]1O[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C13H10O2S/c14-11(10-6-7-16-8-10)13-12(15-13)9-4-2-1-3-5-9/h1-8,12-13H/t12-,13-/m1/s1 |
| InChIKey | ROQYJBKGFQTVNA-CHWSQXEVSA-N |
| XLogP | 3.07 |
| TPSA | 29.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|