C20H24N2O4 — CID 102037936
9-O-tert-butyl 3-O-ethyl 4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11-tetraene-3,9-dicarboxylate (PubChem CID 102037936) has the molecular formula C20H24N2O4 and a molecular weight of 356.42 g/mol. Its IUPAC name is 9-O-tert-butyl 3-O-ethyl 4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11-tetraene-3,9-dicarboxylate.
| Compound Name | 9-O-tert-butyl 3-O-ethyl 4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11-tetraene-3,9-dicarboxylate |
|---|---|
| PubChem CID | 102037936 |
| Molecular Formula | C20H24N2O4 |
| Molecular Weight | 356.42 g/mol |
| Exact Mass | 356.17 |
| IUPAC Name | 9-O-tert-butyl 3-O-ethyl 4,10-diazatetracyclo[5.5.2.02,6.08,12]tetradeca-2,5,8,11-tetraene-3,9-dicarboxylate |
| SMILES | CCOC(=O)c1[nH]cc2c1C1CCC2c2c1c[nH]c2C(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H24N2O4/c1-5-25-18(23)16-14-10-6-7-11(12(14)8-21-16)15-13(10)9-22-17(15)19(24)26-20(2,3)4/h8-11,21-22H,5-7H2,1-4H3 |
| InChIKey | LPIIQMIPCKEDTF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 84.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.42 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |