C14H19NO5 — CID 101339604
4-O-tert-butyl 2-O-(oxiran-2-ylmethyl) 3-methyl-1H-pyrrole-2,4-dicarboxylate (PubChem CID 101339604) has the molecular formula C14H19NO5 and a molecular weight of 281.31 g/mol. Its IUPAC name is 4-O-tert-butyl 2-O-(oxiran-2-ylmethyl) 3-methyl-1H-pyrrole-2,4-dicarboxylate.
| Compound Name | 4-O-tert-butyl 2-O-(oxiran-2-ylmethyl) 3-methyl-1H-pyrrole-2,4-dicarboxylate |
|---|---|
| PubChem CID | 101339604 |
| Molecular Formula | C14H19NO5 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.13 |
| IUPAC Name | 4-O-tert-butyl 2-O-(oxiran-2-ylmethyl) 3-methyl-1H-pyrrole-2,4-dicarboxylate |
| SMILES | Cc1c(C(=O)OC(C)(C)C)c[nH]c1C(=O)OCC1CO1 |
| InChI | InChI=1S/C14H19NO5/c1-8-10(12(16)20-14(2,3)4)5-15-11(8)13(17)19-7-9-6-18-9/h5,9,15H,6-7H2,1-4H3 |
| InChIKey | WQADYVQMHLHSPD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|