C12H20O — CID 102038580
(3R,4S)-5,5-dimethyl-4-prop-2-enyl-1-oxaspiro[2.5]octane (PubChem CID 102038580) has the molecular formula C12H20O and a molecular weight of 180.29 g/mol. Its IUPAC name is (3R,4S)-5,5-dimethyl-4-prop-2-enyl-1-oxaspiro[2.5]octane.
| Compound Name | (3R,4S)-5,5-dimethyl-4-prop-2-enyl-1-oxaspiro[2.5]octane |
|---|---|
| PubChem CID | 102038580 |
| Molecular Formula | C12H20O |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.15 |
| IUPAC Name | (3R,4S)-5,5-dimethyl-4-prop-2-enyl-1-oxaspiro[2.5]octane |
| SMILES | C=CC[C@H]1C(C)(C)CCC[C@]12CO2 |
| InChI | InChI=1S/C12H20O/c1-4-6-10-11(2,3)7-5-8-12(10)9-13-12/h4,10H,1,5-9H2,2-3H3/t10-,12-/m0/s1 |
| InChIKey | MONPUEZTZLGXCS-JQWIXIFHSA-N |
| XLogP | 3.16 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|