C14H10ClN3O3 — CID 102038734
[4-(2H-pyrazolo[3,4-b]pyridin-3-ylmethoxy)phenyl] carbonochloridate (PubChem CID 102038734) has the molecular formula C14H10ClN3O3 and a molecular weight of 303.71 g/mol. Its IUPAC name is [4-(2H-pyrazolo[3,4-b]pyridin-3-ylmethoxy)phenyl] carbonochloridate.
| Compound Name | [4-(2H-pyrazolo[3,4-b]pyridin-3-ylmethoxy)phenyl] carbonochloridate |
|---|---|
| PubChem CID | 102038734 |
| Molecular Formula | C14H10ClN3O3 |
| Molecular Weight | 303.71 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | [4-(2H-pyrazolo[3,4-b]pyridin-3-ylmethoxy)phenyl] carbonochloridate |
| SMILES | O=C(Cl)Oc1ccc(OCc2[nH]nc3ncccc23)cc1 |
| InChI | InChI=1S/C14H10ClN3O3/c15-14(19)21-10-5-3-9(4-6-10)20-8-12-11-2-1-7-16-13(11)18-17-12/h1-7H,8H2,(H,16,17,18) |
| InChIKey | NCFGBHKUHRBYAG-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.71 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|