C9H13NO4 — CID 102038981
1-[(1S)-1-isocyanatoethyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane (PubChem CID 102038981) has the molecular formula C9H13NO4 and a molecular weight of 199.21 g/mol. Its IUPAC name is 1-[(1S)-1-isocyanatoethyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane.
| Compound Name | 1-[(1S)-1-isocyanatoethyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 102038981 |
| Molecular Formula | C9H13NO4 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.08 |
| IUPAC Name | 1-[(1S)-1-isocyanatoethyl]-4-methyl-2,6,7-trioxabicyclo[2.2.2]octane |
| SMILES | C[C@H](N=C=O)C12OCC(C)(CO1)CO2 |
| InChI | InChI=1S/C9H13NO4/c1-7(10-6-11)9-12-3-8(2,4-13-9)5-14-9/h7H,3-5H2,1-2H3/t7-,8?,9?/m0/s1 |
| InChIKey | IUWHPVJYVNFFRG-UEJVZZJDSA-N |
| XLogP | 0.45 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|