C13H21NO6 — CID 58618383
tert-butyl N-[(1S)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)-2-oxoethyl]carbamate (PubChem CID 58618383) has the molecular formula C13H21NO6 and a molecular weight of 288.31 g/mol. Its IUPAC name is tert-butyl N-[(1S)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[(1S)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 58618383 |
| Molecular Formula | C13H21NO6 |
| Molecular Weight | 288.31 g/mol |
| Exact Mass | 288.13 |
| IUPAC Name | tert-butyl N-[(1S)-1-(4-methyl-2,6,7-trioxabicyclo[2.2.2]octan-1-yl)-2-oxoethyl]carbamate |
| SMILES | CC12COC([C@H](C=O)[15NH]C(=O)OC(C)(C)C)(OC1)OC2 |
| InChI | InChI=1S/C13H21NO6/c1-11(2,3)20-10(16)14-9(5-15)13-17-6-12(4,7-18-13)8-19-13/h5,9H,6-8H2,1-4H3,(H,14,16)/t9-,12?,13?/m0/s1/i14+1 |
| InChIKey | QAFXFNWDNUNHIF-ICEMSYQUSA-N |
| XLogP | 0.82 |
| TPSA | 83.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.31 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|